ChemNet > CAS > 881-03-8 2-Methyl-1-nitronaphthalene
881-03-8 2-Methyl-1-nitronaphthalene
| Naam product |
2-Methyl-1-nitronaphthalene |
| Engelse naam |
2-Methyl-1-nitronaphthalene;Naphthalene, 2-methyl-1-nitro-; 1-Nitro-2-methylnaphthalene; 4-05-00-01698 (Beilstein Handbook Reference); BRN 1954310; CCRIS 4680; NSC 7516 |
| MF |
C11H9NO2 |
| Molecuulgewicht |
187.1947 |
| InChI |
InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| CAS-nummer |
881-03-8 |
| EINECS |
212-917-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.234g/cm3 |
| Smeltpunt |
79-82℃ |
| Kookpunt |
320.5°C at 760 mmHg |
| Brekingsindex |
1.652 |
| Vlampunt |
150.4°C |
| Dampdruk |
0.000594mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
