ChemNet > CAS > 881-86-7 Dimethyl 2,5-pyridinedicarboxylate
881-86-7 Dimethyl 2,5-pyridinedicarboxylate
Naam product |
Dimethyl 2,5-pyridinedicarboxylate |
Engelse naam |
Dimethyl 2,5-pyridinedicarboxylate; Dimethyl pyridine-2,5-dicarboxylate; Dimethyl isocinchomeronate; Pyridine-2,5-dicarboxylic acid dimethyl ester; Dimethyl-2,5-pyridinecarboxylate |
MF |
C9H9NO4 |
Molecuulgewicht |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
CAS-nummer |
881-86-7 |
Moleculaire Structuur |
|
Dichtheid |
1.231g/cm3 |
Smeltpunt |
213-217℃ |
Kookpunt |
302.9°C at 760 mmHg |
Brekingsindex |
1.516 |
Vlampunt |
137°C |
Dampdruk |
0.000961mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|