89-79-2 Isopulegol
Naam product |
Isopulegol |
Synoniemen |
; 1-methyl-4-isopropenylcyclohexaan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
Engelse naam |
Isopulegol; 1-Methyl-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
MF |
C10H18O |
Molecuulgewicht |
154.2493 |
InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
CAS-nummer |
89-79-2 |
EINECS |
201-940-6 |
Moleculaire Structuur |
|
Dichtheid |
0.912g/cm3 |
Kookpunt |
197°C at 760 mmHg |
Brekingsindex |
1.472 |
Vlampunt |
78.3°C |
Dampdruk |
0.0993mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
|
|