ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
| Naam product |
2-Hydroxy-4,6-dimethoxyacetophenone |
| Engelse naam |
2-Hydroxy-4,6-dimethoxyacetophenone; xanthoxylin |
| MF |
C10H12O4 |
| Molecuulgewicht |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| CAS-nummer |
90-24-4 |
| EINECS |
201-978-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.172g/cm3 |
| Smeltpunt |
80-82℃ |
| Kookpunt |
355.1°C at 760 mmHg |
| Brekingsindex |
1.527 |
| Vlampunt |
141.2°C |
| Dampdruk |
1.57E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
