ChemNet > CAS > 90-31-3 1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one
90-31-3 1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one
| Naam product |
1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one |
| Engelse naam |
1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one; 2-(3-Chlorophenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one; 1-(3'-Chlorophenyl)-3-methyl-5-pyrazolone; 2-(3-chlorophenyl)-5-methyl-2,4-dihydro-3H-pyrazol-3-one; 1-(3-Chlorophenyl)-3-Methyl-4,5-Dihydro-1H-Pyrazol-5-One; 1-(3-Chlorophenyl)-3-Methyl-5-Pyrazolone |
| MF |
C10H9ClN2O |
| Molecuulgewicht |
208.6443 |
| InChI |
InChI=1/C10H9ClN2O/c1-7-5-10(14)13(12-7)9-4-2-3-8(11)6-9/h2-4,6H,5H2,1H3 |
| CAS-nummer |
90-31-3 |
| EINECS |
201-984-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.32g/cm3 |
| Smeltpunt |
128-131℃ |
| Kookpunt |
382.9°C at 760 mmHg |
| Brekingsindex |
1.625 |
| Vlampunt |
185.4°C |
| Dampdruk |
4.57E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
