ChemNet > CAS > 9003-20-7 Poly(vinyl acetate)
9003-20-7 Poly(vinyl acetate)
| Naam product |
Poly(vinyl acetate) |
| Engelse naam |
Poly(vinyl acetate); PolyvinylacetateMWca; poly(1-acetoxyethylene); Vinyl Acetate Resin (Low M.Wt.); Vinyl Acetate Latex (Med.Particle Size); Vinyl Acetate Latex (Large Particle Size); Vinyl Acetate Resin (Med.M.Wt.); Vinyl Acetate Resin(High M.Wt.); Polyvinyl Acetate; methyl prop-2-enoate; Polymer vinyl acetate; PVAC |
| MF |
C4H6O2 |
| Molecuulgewicht |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
| CAS-nummer |
9003-20-7 |
| EINECS |
202-500-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.924g/cm3 |
| Kookpunt |
80.2°C at 760 mmHg |
| Brekingsindex |
1.39 |
| Vlampunt |
6.7°C |
| Dampdruk |
86.3mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
