9003-42-3 Poly(ethylmethacrylaat)
Naam product |
Poly(ethylmethacrylaat) |
Synoniemen |
Ethylmethacrylaathars; ethyl-2-methylprop-2-enoaat |
Engelse naam |
Poly(ethyl methacrylate); Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
MF |
C6H10O2 |
Molecuulgewicht |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
CAS-nummer |
9003-42-3 |
EINECS |
202-597-5 |
Moleculaire Structuur |
|
Dichtheid |
0.906g/cm3 |
Kookpunt |
120.5°C at 760 mmHg |
Brekingsindex |
1.409 |
Vlampunt |
15.6°C |
Dampdruk |
15.2mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|