ChemNet > CAS > 9003-79-6 Aceton, oligomere reactieproducten met difenylamine
9003-79-6 Aceton, oligomere reactieproducten met difenylamine
Naam product |
Aceton, oligomere reactieproducten met difenylamine |
Synoniemen |
2-Propanone, polymeer met N-fenylbenzenamine; 3,5-di-tert-butyl-4-hydroxy-hydrokaneelzuur Triester van 1,3,5-tris(2-hydroxyethyl)-S-triazine-2,4,6-(1H,3H,5H)-trione |
Engelse naam |
Acetone, oligomeric reaction products with diphenylamine;2-Propanone, polymer with N-phenylbenzenamine; 3,5-Di-Tert-Butyl-4-Hydroxy-Hydrocinnamic Acid Triester Of 1,3,5-Tris(2-Hydroxyethyl)-S-Triazine-2,4,6-(1H,3H,5H)-Trione |
MF |
(C12H11N・C3H6O)x |
Molecuulgewicht |
227.305 |
InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
CAS-nummer |
9003-79-6 |
EINECS |
500-009-4 |
Moleculaire Structuur |
|
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|