ChemNet > CAS > 9010-86-0 Ethyleen/ethylacrylaatcopolymeer
9010-86-0 Ethyleen/ethylacrylaatcopolymeer
Naam product |
Ethyleen/ethylacrylaatcopolymeer |
Synoniemen |
;P oly (ethyleen-co-ethylacrylaat); ethylprop-2-enoaat - etheen (1:1) |
Engelse naam |
Ethylene/ethyl acrylate copolymer; Poly(ethylene-co-ethyl acrylate); ethyl prop-2-enoate - ethene (1:1) |
MF |
C7H12O2 |
Molecuulgewicht |
128.169 |
InChI |
InChI=1/C5H8O2.C2H4/c1-3-5(6)7-4-2;1-2/h3H,1,4H2,2H3;1-2H2 |
CAS-nummer |
9010-86-0 |
Moleculaire Structuur |
|
Kookpunt |
99.5°C at 760 mmHg |
Vlampunt |
15.6°C |
Dampdruk |
38.2mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|