ChemNet > CAS > 9011-14-7;9065-11-6 Poly(methyl methacrylate)
9011-14-7;9065-11-6 Poly(methyl methacrylate)
| Naam product |
Poly(methyl methacrylate) |
| Engelse naam |
Poly(methyl methacrylate); Methyl Methacrylate Resin (High M.Wt.); Methacrylic Acid Methyl Ester, Polymer n=13,500-14,000; PMMA; 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer; Acryloid; Methyl methacrylate homopolymer; Methyl methacrylate, polymerized; Methyl methacrylate resin; Poly(methyl methacrylate), beads |
| MF |
(C5H8O2)x |
| Molecuulgewicht |
99.1083 |
| InChI |
InChI=1/C5H7O2/c1-4(2)5(6)7-3/h1H,2-3H3 |
| CAS-nummer |
9011-14-7;9065-11-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.18 |
| Smeltpunt |
105℃ |
| Brekingsindex |
1.49 |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
