928-47-2 S-n-Butyl thioacetate
Naam product |
S-n-Butyl thioacetate |
Engelse naam |
S-n-Butyl thioacetate; Thioacetic acid S-n-butyl ester; S-butyl ethanethioate; S-butan-2-yl ethanethioate |
MF |
C6H12OS |
Molecuulgewicht |
132.2239 |
InChI |
InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
CAS-nummer |
928-47-2 |
Moleculaire Structuur |
|
Dichtheid |
0.95g/cm3 |
Kookpunt |
158.1°C at 760 mmHg |
Brekingsindex |
1.456 |
Vlampunt |
44°C |
Dampdruk |
2.67mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|