932-66-1 1-Acetyl-1-cyclohexene
Naam product |
1-Acetyl-1-cyclohexene |
Engelse naam |
1-Acetyl-1-cyclohexene; cyclohex-1-enyl methyl ketone; 1-(cyclohex-1-en-1-yl)ethanone |
MF |
C8H12O |
Molecuulgewicht |
124.1803 |
InChI |
InChI=1/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
CAS-nummer |
932-66-1 |
EINECS |
213-256-5 |
Moleculaire Structuur |
|
Dichtheid |
0.962g/cm3 |
Smeltpunt |
73-202℃ |
Kookpunt |
201.7°C at 760 mmHg |
Brekingsindex |
1.477 |
Vlampunt |
73.2°C |
Dampdruk |
0.304mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|