ChemNet > CAS > 934-48-5 3,5-Dimethylpyrazole-1-carboxamide
934-48-5 3,5-Dimethylpyrazole-1-carboxamide
Naam product |
3,5-Dimethylpyrazole-1-carboxamide |
Engelse naam |
3,5-Dimethylpyrazole-1-carboxamide; 1-Carboxamido-3,5-dimethylpyrazole; 3,5-Dimethyl-1H-pyrazole-1-carboxamide |
MF |
C6H9N3O |
Molecuulgewicht |
139.1552 |
InChI |
InChI=1/C6H9N3O/c1-4-3-5(2)9(8-4)6(7)10/h3H,1-2H3,(H2,7,10) |
CAS-nummer |
934-48-5 |
EINECS |
213-283-2 |
Moleculaire Structuur |
|
Dichtheid |
1.28g/cm3 |
Smeltpunt |
110-113℃ |
Kookpunt |
296.8°C at 760 mmHg |
Brekingsindex |
1.6 |
Vlampunt |
133.3°C |
Dampdruk |
0.0014mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|