ChemNet > CAS > 935-44-4 1-fenyl-1-cyclopropaancarbonitril
935-44-4 1-fenyl-1-cyclopropaancarbonitril
| Naam product |
1-fenyl-1-cyclopropaancarbonitril |
| Synoniemen |
1-fenylcyclopropaancarbonitril |
| Engelse naam |
1-Phenyl-1-cyclopropanecarbonitrile;1-Phenylcyclopropanecarbonitrile |
| MF |
C10H9N |
| Molecuulgewicht |
143.1852 |
| InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| CAS-nummer |
935-44-4 |
| EINECS |
213-304-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.09g/cm3 |
| Kookpunt |
238.5°C at 760 mmHg |
| Brekingsindex |
1.571 |
| Vlampunt |
99°C |
| Dampdruk |
0.0422mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
