ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
Naam product |
2-Methyl-5-nitrobenzonitrile |
Engelse naam |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
MF |
C8H6N2O2 |
Molecuulgewicht |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
CAS-nummer |
939-83-3 |
Moleculaire Structuur |
|
Dichtheid |
1.26g/cm3 |
Smeltpunt |
103.5-107.5℃ |
Kookpunt |
291.5°C at 760 mmHg |
Brekingsindex |
1.568 |
Vlampunt |
130.1°C |
Dampdruk |
0.00194mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|