943-93-1 1,2-Epoxy-5,9-cyclododecadiene

Naam product	1,2-Epoxy-5,9-cyclododecadiene
Engelse naam	1,2-Epoxy-5,9-cyclododecadiene;
MF	C₁₂H₁₈O
Molecuulgewicht	178.2707
InChI	InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+
CAS-nummer	943-93-1
EINECS	213-407-5
Moleculaire Structuur
Dichtheid	0.941g/cm³
Kookpunt	269.8°C at 760 mmHg
Brekingsindex	1.484
Vlampunt	113.6°C
Dampdruk	0.0118mmHg at 25°C
Gevaarsymbolen
Risico-codes	R36/38:Irritating to eyes and skin.;
Veiligheid Omschrijving	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;