ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
Naam product |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
Engelse naam |
4-amino-2,3,5,6-tetrafluorobenzoic acid; |
MF |
C7H3F4NO2 |
Molecuulgewicht |
209.0978 |
InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
CAS-nummer |
944-43-4 |
EINECS |
213-409-6 |
Moleculaire Structuur |
|
Dichtheid |
1.726g/cm3 |
Smeltpunt |
185-187℃ |
Kookpunt |
283.6°C at 760 mmHg |
Brekingsindex |
1.529 |
Vlampunt |
125.3°C |
Dampdruk |
0.00148mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|