95-63-6 1,2,4-Trimethylbenzene
Naam product |
1,2,4-Trimethylbenzene |
Engelse naam |
1,2,4-Trimethylbenzene; Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
MF |
C9H12 |
Molecuulgewicht |
120.19 |
InChI |
InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
CAS-nummer |
95-63-6 |
EINECS |
202-436-9 |
Moleculaire Structuur |
|
Dichtheid |
0.88 |
Smeltpunt |
-44℃ |
Kookpunt |
168℃ |
Brekingsindex |
1.503-1.505 |
Vlampunt |
48℃ |
Gevaarsymbolen |
Xn:Harmful;
N:Dangerous for the environment;
|
Risico-codes |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|