959-22-8 4-Nitrophenyl benzoate
Naam product |
4-Nitrophenyl benzoate |
Engelse naam |
4-Nitrophenyl benzoate; Benzoic acid 4-nitrophenyl ester |
MF |
C13H9NO4 |
Molecuulgewicht |
243.2149 |
InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
CAS-nummer |
959-22-8 |
Moleculaire Structuur |
|
Dichtheid |
1.316g/cm3 |
Kookpunt |
399.5°C at 760 mmHg |
Brekingsindex |
1.614 |
Vlampunt |
183.5°C |
Dampdruk |
1.37E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|