ChemNet > CAS > 959-28-4 trans-1,2-Dibenzoylethylene
959-28-4 trans-1,2-Dibenzoylethylene
Naam product |
trans-1,2-Dibenzoylethylene |
Engelse naam |
trans-1,2-Dibenzoylethylene; trans-1,4-Diphenyl-2-butene-1,4-dione; 1,2-Dibenzoylethylene, perdominantly trans, (trans-1,4-Diphenyl-2-butene-1,4-dione); (2E)-1,4-diphenylbut-2-ene-1,4-dione |
MF |
C16H12O2 |
Molecuulgewicht |
236.2653 |
InChI |
InChI=1/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
CAS-nummer |
959-28-4 |
EINECS |
213-498-1 |
Moleculaire Structuur |
|
Dichtheid |
1.141g/cm3 |
Smeltpunt |
108-112℃ |
Kookpunt |
368.5°C at 760 mmHg |
Brekingsindex |
1.597 |
Vlampunt |
138.2°C |
Dampdruk |
1.27E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|