97-95-0 2-Ethyl-1-butanol
Naam product |
2-Ethyl-1-butanol |
Engelse naam |
2-Ethyl-1-butanol; 2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
MF |
C6H14O |
Molecuulgewicht |
102.1748 |
InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS-nummer |
97-95-0 |
EINECS |
202-621-4 |
Moleculaire Structuur |
|
Dichtheid |
0.814g/cm3 |
Smeltpunt |
-15℃ |
Kookpunt |
146.5°C at 760 mmHg |
Brekingsindex |
1.413 |
Vlampunt |
58.3°C |
Dampdruk |
1.81mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
|
|