ChemNet > CAS > 99-20-7 D-Trehalose anhydrous
99-20-7 D-Trehalose anhydrous
| Naam product |
D-Trehalose anhydrous |
| Engelse naam |
D-Trehalose anhydrous; Trehalose; alpha-D-Trehalose; alpha-D-glucopyranosyl alpha-D-glucopyranoside; Trehalose; D(+)Trehalose; D-(+)-Trehalose; α-L-glucopyranosyl; α-D-glucopyranoside; Trehalose anhydrous |
| MF |
C12H22O11 |
| Molecuulgewicht |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| CAS-nummer |
99-20-7 |
| EINECS |
202-739-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.76g/cm3 |
| Smeltpunt |
214-216℃ |
| Kookpunt |
675.4°C at 760 mmHg |
| Brekingsindex |
1.652 |
| Vlampunt |
362.3°C |
| Dampdruk |
3.87E-21mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
