ChemNet > CAS > 99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
Naam product |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
Engelse naam |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide; Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-; 4'-Amino-5'-methoxy-2'-methylbenzanilide; 4-amino-5-methoxy-2-methyl-N-phenylbenzamide; Fast Violet Base B; FAST VIOLER B BASE |
MF |
C15H16N2O2 |
Molecuulgewicht |
256.2997 |
InChI |
InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
CAS-nummer |
99-21-8 |
EINECS |
202-740-1 |
Moleculaire Structuur |
|
Dichtheid |
1.215g/cm3 |
Smeltpunt |
185℃ |
Kookpunt |
384.7°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
186.5°C |
Dampdruk |
4.01E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|