10079-53-5;5344-78-5 4-bromo-3-nitroanisole
produktnavn |
4-bromo-3-nitroanisole |
Engelsk navn |
4-bromo-3-nitroanisole; 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
Molekylær Formel |
C7H6BrNO3 |
Molekylvekt |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
CAS-nummer |
10079-53-5;5344-78-5 |
EINECS |
226-290-0 |
Molecular Structure |
|
Tetthet |
1.64g/cm3 |
Smeltepunkt |
32-34℃ |
Kokepunkt |
291°C at 760 mmHg |
Brytningsindeks |
1.581 |
Flammepunktet |
123°C |
Damptrykk |
0.00349mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|