ChemNet > CAS > 1008-76-0 Gamma-Phenyl-Gamma-butyrolactone
1008-76-0 Gamma-Phenyl-Gamma-butyrolactone
produktnavn |
Gamma-Phenyl-Gamma-butyrolactone |
Engelsk navn |
Gamma-Phenyl-Gamma-butyrolactone; 4,5-Dihydro-5-phenyl-2(3H)-furanone; 5-phenyldihydrofuran-2(3H)-one; (5R)-5-phenyldihydrofuran-2(3H)-one; (5S)-5-phenyldihydrofuran-2(3H)-one |
Molekylær Formel |
C10H10O2 |
Molekylvekt |
162.1852 |
InChI |
InChI=1/C10H10O2/c11-10-7-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
CAS-nummer |
1008-76-0 |
EINECS |
213-761-0 |
Molecular Structure |
|
Tetthet |
1.154g/cm3 |
Smeltepunkt |
36-37℃ |
Kokepunkt |
306°C at 760 mmHg |
Brytningsindeks |
1.548 |
Flammepunktet |
135.5°C |
Damptrykk |
0.000793mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|