ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
| produktnavn |
2-Chloro isonicotinamide |
| Engelsk navn |
2-Chloro isonicotinamide;6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| Molekylær Formel |
C6H5ClN2O |
| Molekylvekt |
156.5697 |
| InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS-nummer |
100859-84-5 |
| Molecular Structure |
|
| Tetthet |
1.381g/cm3 |
| Smeltepunkt |
193℃ |
| Kokepunkt |
312.2°C at 760 mmHg |
| Brytningsindeks |
1.588 |
| Flammepunktet |
142.6°C |
| Damptrykk |
0.000535mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
