101-17-7 3-Chlorodiphenylamine
produktnavn |
3-Chlorodiphenylamine |
Engelsk navn |
3-Chlorodiphenylamine; Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
Molekylær Formel |
C12H10ClN |
Molekylvekt |
203.6675 |
InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
CAS-nummer |
101-17-7 |
EINECS |
202-922-0 |
Molecular Structure |
|
Tetthet |
1.216g/cm3 |
Kokepunkt |
337.8°C at 760 mmHg |
Brytningsindeks |
1.642 |
Flammepunktet |
147.4°C |
Damptrykk |
0.000102mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|