The physical and chemical property of 101-69-9 is provided by ChemNet.com
Chemical CAS Database with Global Chemical Suppliers - ChemNet


   ChemNet > CAS > 101-69-9 variamine blue B salt

101-69-9 variamine blue B salt

produktnavn variamine blue B salt
Engelsk navn variamine blue B salt; Variamine blue diazonium salt; 4-[(4-methoxyphenyl)amino]benzenediazonium chloride
Molekylær Formel C13H12ClN3O
Molekylvekt 261.7069
InChI InChI=1/C13H12N3O.ClH/c1-17-13-8-6-11(7-9-13)15-10-2-4-12(16-14)5-3-10;/h2-9,15H,1H3;1H/q+1;/p-1
CAS-nummer 101-69-9
EINECS 202-967-6
Molecular Structure 101-69-9 variamine blue B salt
Hazard symboler
Risiko Koder
Sikkerhet Beskrivelse