103-78-6 cyclohexylacetone
produktnavn |
cyclohexylacetone |
Engelsk navn |
cyclohexylacetone; Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
Molekylær Formel |
C9H16O |
Molekylvekt |
140.2227 |
InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS-nummer |
103-78-6 |
EINECS |
203-143-9 |
Molecular Structure |
|
Tetthet |
0.889g/cm3 |
Kokepunkt |
188.1°C at 760 mmHg |
Brytningsindeks |
1.441 |
Flammepunktet |
65.3°C |
Damptrykk |
0.609mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|