ChemNet > CAS > 10328-92-4 N-Methylisatoic anhydride
10328-92-4 N-Methylisatoic anhydride
produktnavn |
N-Methylisatoic anhydride |
Engelsk navn |
N-Methylisatoic anhydride; MIA; N-Methylisatoic Anhydride; 1-methyl-2H-3,1-benzoxazine-2,4(1H)-dione |
Molekylær Formel |
C9H7NO3 |
Molekylvekt |
177.1568 |
InChI |
InChI=1/C9H7NO3/c1-10-7-5-3-2-4-6(7)8(11)13-9(10)12/h2-5H,1H3 |
CAS-nummer |
10328-92-4 |
EINECS |
233-714-8 |
Molecular Structure |
|
Tetthet |
1.348g/cm3 |
Smeltepunkt |
165℃ |
Kokepunkt |
297.5°C at 760 mmHg |
Brytningsindeks |
1.583 |
Flammepunktet |
133.7°C |
Damptrykk |
0.00135mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|