10477-47-1 Propargyl acrylate
produktnavn |
Propargyl acrylate |
Engelsk navn |
Propargyl acrylate; Acrylic acid propargyl ester~2-Propyn-1-yl propenoate; prop-2-yn-1-yl prop-2-enoate |
Molekylær Formel |
C6H6O2 |
Molekylvekt |
110.1106 |
InChI |
InChI=1/C6H6O2/c1-3-5-8-6(7)4-2/h1,4H,2,5H2 |
CAS-nummer |
10477-47-1 |
EINECS |
233-975-8 |
Molecular Structure |
|
Tetthet |
1.001g/cm3 |
Kokepunkt |
129.1°C at 760 mmHg |
Brytningsindeks |
1.443 |
Flammepunktet |
32.2°C |
Damptrykk |
10.3mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|