106-42-3 p-Xylene
produktnavn |
p-Xylene |
Engelsk navn |
p-Xylene; 1,4-Dimethylbenzene; para-xylene; Dibencoside; 1,4-xylene |
Molekylær Formel |
C8H10 |
Molekylvekt |
106.1674 |
InChI |
InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
CAS-nummer |
106-42-3 |
EINECS |
203-396-5 |
Molecular Structure |
|
Smeltepunkt |
13-13℃ |
Kokepunkt |
139.61°C at 760 mmHg |
Flammepunktet |
24.627°C |
Damptrykk |
7.943mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
Sikkerhet Beskrivelse |
S25:Avoid contact with eyes.;
|
|