ChemNet > CAS > 1076-74-0 5-Methoxy-2-methylindole
1076-74-0 5-Methoxy-2-methylindole
produktnavn |
5-Methoxy-2-methylindole |
Engelsk navn |
5-Methoxy-2-methylindole;5-methoxy-2-methyl-1H-indole |
Molekylær Formel |
C10H11NO |
Molekylvekt |
161.2004 |
InChI |
InChI=1/C10H11NO/c1-7-5-8-6-9(12-2)3-4-10(8)11-7/h3-6,11H,1-2H3 |
CAS-nummer |
1076-74-0 |
EINECS |
214-066-5 |
Molecular Structure |
|
Tetthet |
1.134g/cm3 |
Smeltepunkt |
85-88℃ |
Kokepunkt |
308.5°C at 760 mmHg |
Brytningsindeks |
1.621 |
Flammepunktet |
113.1°C |
Damptrykk |
0.00123mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|