ChemNet > CAS > 109887-53-8 (3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine
109887-53-8 (3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine
| produktnavn |
(3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| Engelsk navn |
(3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine; 4-(4-Fluorophenyl)-3-hydroxymethyl-1-methyl-piperidine; (±)trans-4-(4-fluorophenyl)-3-hydroxymethyl-1-methyl piperidine; (-)-Trans-1-Methyl-3-Hydroxymethyl-4-(4-fluorophenyl) piperidine; Trans-4-(4-Fluorophenyl)-3-hydroxy methyl-N-methyl piperidine; NMA; [4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| Molekylær Formel |
C13H18FNO |
| Molekylvekt |
223.2865 |
| InChI |
InChI=1/C13H18FNO/c1-15-7-6-13(11(8-15)9-16)10-2-4-12(14)5-3-10/h2-5,11,13,16H,6-9H2,1H3 |
| CAS-nummer |
109887-53-8 |
| Molecular Structure |
|
| Tetthet |
1.092g/cm3 |
| Smeltepunkt |
100℃ |
| Kokepunkt |
300.283°C at 760 mmHg |
| Brytningsindeks |
1.518 |
| Flammepunktet |
135.406°C |
| Damptrykk |
0.001mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
