ChemNet > CAS > 1099-02-1 N,N,N',N'-1,4-Phenylenediaminetetraacetic acid
1099-02-1 N,N,N',N'-1,4-Phenylenediaminetetraacetic acid
produktnavn |
N,N,N',N'-1,4-Phenylenediaminetetraacetic acid |
Engelsk navn |
N,N,N',N'-1,4-Phenylenediaminetetraacetic acid;2,2',2'',2'''-(benzene-1,4-diyldinitrilo)tetraacetic acid |
Molekylær Formel |
C14H16N2O8 |
Molekylvekt |
340.2854 |
InChI |
InChI=1/C14H16N2O8/c17-11(18)5-15(6-12(19)20)9-1-2-10(4-3-9)16(7-13(21)22)8-14(23)24/h1-4H,5-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
CAS-nummer |
1099-02-1 |
Molecular Structure |
|
Tetthet |
1.62g/cm3 |
Kokepunkt |
744.2°C at 760 mmHg |
Brytningsindeks |
1.683 |
Flammepunktet |
403.9°C |
Damptrykk |
2.91E-23mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|