ChemNet > CAS > 109919-26-8 2-bromo-6-chloro-4-(trifluoromethyl)aniline
109919-26-8 2-bromo-6-chloro-4-(trifluoromethyl)aniline
| produktnavn |
2-bromo-6-chloro-4-(trifluoromethyl)aniline |
| Engelsk navn |
2-bromo-6-chloro-4-(trifluoromethyl)aniline; 2-Bromo-6-chloro-4-trifluoromethylaniline; 4-Amino-3-bromo-5-chlorobenzotrifluoride; 4,5,5-trifluoropent-4-en-1-ol |
| Molekylær Formel |
C5H7F3O |
| Molekylvekt |
140.1037 |
| InChI |
InChI=1/C5H7F3O/c6-4(5(7)8)2-1-3-9/h9H,1-3H2 |
| CAS-nummer |
109919-26-8 |
| Molecular Structure |
|
| Tetthet |
1.185g/cm3 |
| Smeltepunkt |
27-32℃ |
| Kokepunkt |
149.5°C at 760 mmHg |
| Brytningsindeks |
1.374 |
| Flammepunktet |
64.4°C |
| Damptrykk |
1.53mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
