ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
| produktnavn |
2,6-Dibromo-4-nitrotoluene |
| Engelsk navn |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
| Molekylær Formel |
C7H5Br2NO2 |
| Molekylvekt |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| CAS-nummer |
110127-07-6 |
| Molecular Structure |
|
| Tetthet |
1.967g/cm3 |
| Kokepunkt |
320.4°C at 760 mmHg |
| Brytningsindeks |
1.625 |
| Flammepunktet |
147.6°C |
| Damptrykk |
0.000598mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
