ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
produktnavn |
Triethyleneglycoldiacetate |
Engelsk navn |
Triethyleneglycoldiacetate; Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
Molekylær Formel |
C10H18O6 |
Molekylvekt |
234.2463 |
InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
CAS-nummer |
111-21-7 |
EINECS |
203-846-0 |
Molecular Structure |
|
Tetthet |
1.098g/cm3 |
Kokepunkt |
286°C at 760 mmHg |
Brytningsindeks |
1.432 |
Flammepunktet |
125.2°C |
Damptrykk |
0.00271mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|