1123-00-8 Cyclopentylacetic acid
produktnavn |
Cyclopentylacetic acid |
Engelsk navn |
Cyclopentylacetic acid; Cyclopentaneacetic acid; cycylopentylacetic acid; cyclopentylacetate |
Molekylær Formel |
C7H11O2 |
Molekylvekt |
127.1616 |
InChI |
InChI=1/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9)/p-1 |
CAS-nummer |
1123-00-8 |
EINECS |
214-368-7 |
Molecular Structure |
|
Kokepunkt |
230.2°C at 760 mmHg |
Flammepunktet |
114°C |
Damptrykk |
0.0237mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|