ChemNet > CAS > 1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
produktnavn |
1,4-Diiodo-2,5-dimethylbenzene |
Engelsk navn |
1,4-Diiodo-2,5-dimethylbenzene; 2,5-Diiodo-p-xylene
|
Molekylær Formel |
C8H8I2 |
Molekylvekt |
357.9581 |
InChI |
InChI=1/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 |
CAS-nummer |
1124-08-9 |
Molecular Structure |
|
Tetthet |
2.154g/cm3 |
Smeltepunkt |
103℃ |
Kokepunkt |
306.2°C at 760 mmHg |
Brytningsindeks |
1.665 |
Flammepunktet |
147.6°C |
Damptrykk |
0.00142mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|