ChemNet > CAS > 1128-76-3 Ethyl 3-chlorobenzoate
1128-76-3 Ethyl 3-chlorobenzoate
produktnavn |
Ethyl 3-chlorobenzoate |
Engelsk navn |
Ethyl 3-chlorobenzoate; 3-Chlorobenzoic acid ethyl ester |
Molekylær Formel |
C9H9ClO2 |
Molekylvekt |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS-nummer |
1128-76-3 |
EINECS |
214-441-3 |
Molecular Structure |
|
Tetthet |
1.185g/cm3 |
Kokepunkt |
243°C at 760 mmHg |
Brytningsindeks |
1.522 |
Flammepunktet |
115.2°C |
Damptrykk |
0.0329mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|