ChemNet > CAS > 1133-77-3 1-fenyl-1H-pyrazol-5-karboksylsyre
1133-77-3 1-fenyl-1H-pyrazol-5-karboksylsyre
| produktnavn |
1-fenyl-1H-pyrazol-5-karboksylsyre |
| Engelsk navn |
1-phenyl-1H-pyrazole-5-carboxylic acid; |
| Molekylær Formel |
C10H8N2O2 |
| Molekylvekt |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c13-10(14)9-6-7-11-12(9)8-4-2-1-3-5-8/h1-7H,(H,13,14) |
| CAS-nummer |
1133-77-3 |
| Molecular Structure |
|
| Tetthet |
1.28g/cm3 |
| Smeltepunkt |
183℃ |
| Kokepunkt |
379.6°C at 760 mmHg |
| Brytningsindeks |
1.631 |
| Flammepunktet |
183.4°C |
| Damptrykk |
1.93E-06mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
