ChemNet > CAS > 114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
produktnavn |
(3S)-(-)-3-Acetamidopyrrolidine |
Engelsk navn |
(3S)-(-)-3-Acetamidopyrrolidine; N-[(3R)-pyrrolidin-3-yl]acetamide; N-[(3S)-pyrrolidin-3-yl]acetamide |
Molekylær Formel |
C6H12N2O |
Molekylvekt |
128.1723 |
InChI |
InChI=1/C6H12N2O/c1-5(9)8-6-2-3-7-4-6/h6-7H,2-4H2,1H3,(H,8,9)/t6-/m0/s1 |
CAS-nummer |
114636-31-6 |
Molecular Structure |
|
Tetthet |
1.04g/cm3 |
Kokepunkt |
306.8°C at 760 mmHg |
Brytningsindeks |
1.485 |
Flammepunktet |
150.8°C |
Damptrykk |
0.000752mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|