ChemNet > CAS > 116493-07-3 4-cyano-3-(4-metoksyfenyl)-5-(metyltio)tiofen-2-karboksylsyre
116493-07-3 4-cyano-3-(4-metoksyfenyl)-5-(metyltio)tiofen-2-karboksylsyre
produktnavn |
4-cyano-3-(4-metoksyfenyl)-5-(metyltio)tiofen-2-karboksylsyre |
Synonymer |
4-cyano-3-(4-metoksyfenyl)-5-(metylsulfanyl)tiofen-2-karboksylsyre |
Engelsk navn |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
Molekylær Formel |
C14H11NO3S2 |
Molekylvekt |
305.372 |
InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
CAS-nummer |
116493-07-3 |
Molecular Structure |
|
Tetthet |
1.43g/cm3 |
Smeltepunkt |
209℃ |
Kokepunkt |
464.9°C at 760 mmHg |
Brytningsindeks |
1.67 |
Flammepunktet |
234.9°C |
Damptrykk |
1.93E-09mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|