ChemNet > CAS > 1187-34-4 etyl N-(2-cyano-3-etoksyakryloyl)karbamat
1187-34-4 etyl N-(2-cyano-3-etoksyakryloyl)karbamat
| produktnavn |
etyl N-(2-cyano-3-etoksyakryloyl)karbamat |
| Synonymer |
etyl [(2E)-2-cyano-3-etoksyprop-2-enoyl]karbamat |
| Engelsk navn |
ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate;ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| Molekylær Formel |
C9H12N2O4 |
| Molekylvekt |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| CAS-nummer |
1187-34-4 |
| Molecular Structure |
|
| Tetthet |
1.181g/cm3 |
| Smeltepunkt |
116℃ |
| Brytningsindeks |
1.476 |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
