ChemNet > CAS > 119237-64-8 (S)-(-)-2-(diphenylmethyl)pyrrolidine
119237-64-8 (S)-(-)-2-(diphenylmethyl)pyrrolidine
| produktnavn |
(S)-(-)-2-(diphenylmethyl)pyrrolidine |
| Engelsk navn |
(S)-(-)-2-(diphenylmethyl)pyrrolidine; (S)-2-Diphenylmethylpyrrolidine; (S)-(+)-2-(Diphenylmethyl)pyrrolidine; 2-(diphenylmethyl)pyrrolidine; (2S)-2-(diphenylmethyl)pyrrolidine; (2S)-2-(diphenylmethyl)pyrrolidinium |
| Molekylær Formel |
C17H20N |
| Molekylvekt |
238.3469 |
| InChI |
InChI=1/C17H19N/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/p+1/t16-/m0/s1 |
| CAS-nummer |
119237-64-8 |
| Molecular Structure |
|
| Kokepunkt |
349.6°C at 760 mmHg |
| Flammepunktet |
170.8°C |
| Damptrykk |
4.64E-05mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
