ChemNet > CAS > 1195-09-1 3-Hydroxy-4-methoxytoluene
1195-09-1 3-Hydroxy-4-methoxytoluene
produktnavn |
3-Hydroxy-4-methoxytoluene |
Engelsk navn |
3-Hydroxy-4-methoxytoluene; 2-Methoxy-5-methylphenol; Isocreosol~5-Methylguaiacol |
Molekylær Formel |
C8H10O2 |
Molekylvekt |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-6-3-4-8(10-2)7(9)5-6/h3-5,9H,1-2H3 |
CAS-nummer |
1195-09-1 |
EINECS |
214-791-7 |
Molecular Structure |
|
Tetthet |
1.078g/cm3 |
Kokepunkt |
226.4°C at 760 mmHg |
Brytningsindeks |
1.53 |
Flammepunktet |
99°C |
Damptrykk |
0.0546mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|