ChemNet > CAS > 1198-47-6 2-Amino-6-methylmercaptopurine
1198-47-6 2-Amino-6-methylmercaptopurine
produktnavn |
2-Amino-6-methylmercaptopurine |
Engelsk navn |
2-Amino-6-methylmercaptopurine; |
Molekylær Formel |
C6H7N5S |
Molekylvekt |
181.2183 |
InChI |
InChI=1/C6H7N5S/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2-3H,1H3,(H2,7,8,9,10) |
CAS-nummer |
1198-47-6 |
EINECS |
214-833-4 |
Molecular Structure |
|
Tetthet |
1.78g/cm3 |
Smeltepunkt |
234-237℃ |
Kokepunkt |
344.1°C at 760 mmHg |
Brytningsindeks |
1.892 |
Flammepunktet |
161.9°C |
Damptrykk |
6.74E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|