ChemNet > CAS > 120800-52-4 6-morpholinonicotinic acid
120800-52-4 6-morpholinonicotinic acid
produktnavn |
6-morpholinonicotinic acid |
Engelsk navn |
6-morpholinonicotinic acid; 6-morpholinopyridine-3-carboxylic acid |
Molekylær Formel |
C10H12N2O3 |
Molekylvekt |
208.2139 |
InChI |
InChI=1/C10H12N2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14) |
CAS-nummer |
120800-52-4 |
Molecular Structure |
|
Tetthet |
1.314g/cm3 |
Smeltepunkt |
261℃ |
Kokepunkt |
446.074°C at 760 mmHg |
Brytningsindeks |
1.585 |
Flammepunktet |
223.578°C |
Damptrykk |
0mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|