ChemNet > CAS > 1211-35-4 2-(4-chlorophenyl)-1H-indole
1211-35-4 2-(4-chlorophenyl)-1H-indole
produktnavn |
2-(4-chlorophenyl)-1H-indole |
Engelsk navn |
2-(4-chlorophenyl)-1H-indole; 2-(4-Chlorophenyl)indole |
Molekylær Formel |
C14H10ClN |
Molekylvekt |
227.6889 |
InChI |
InChI=1/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
CAS-nummer |
1211-35-4 |
Molecular Structure |
|
Tetthet |
1.271g/cm3 |
Kokepunkt |
417.8°C at 760 mmHg |
Brytningsindeks |
1.684 |
Flammepunktet |
239°C |
Damptrykk |
8.36E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|